C8H5F3NOY+2 — CID 54717323
2,2,2-trifluoro-N-phenylacetamide;yttrium(3+) (PubChem CID 54717323) has the molecular formula C8H5F3NOY+2 and a molecular weight of 277.03 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-phenylacetamide;yttrium(3+).
| Compound Name | 2,2,2-trifluoro-N-phenylacetamide;yttrium(3+) |
|---|---|
| PubChem CID | 54717323 |
| Molecular Formula | C8H5F3NOY+2 |
| Molecular Weight | 277.03 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 2,2,2-trifluoro-N-phenylacetamide;yttrium(3+) |
| SMILES | O=C(Nc1[c-]cccc1)C(F)(F)F.[Y+3] |
| InChI | InChI=1S/C8H5F3NO.Y/c9-8(10,11)7(13)12-6-4-2-1-3-5-6;/h1-4H,(H,12,13);/q-1;+3 |
| InChIKey | VGBDRZLYKQPLGQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.03 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|