C9H5ClF3NO2 — CID 142053542
N-(4-chloro-3-formylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 142053542) has the molecular formula C9H5ClF3NO2 and a molecular weight of 251.59 g/mol. Its IUPAC name is N-(4-chloro-3-formylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-chloro-3-formylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142053542 |
| Molecular Formula | C9H5ClF3NO2 |
| Molecular Weight | 251.59 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | N-(4-chloro-3-formylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=Cc1cc(NC(=O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C9H5ClF3NO2/c10-7-2-1-6(3-5(7)4-15)14-8(16)9(11,12)13/h1-4H,(H,14,16) |
| InChIKey | DRYVGNVSNKUWDK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|