C11H10F3NO2 — CID 86632821
2,2,2-trifluoro-N-(4-formyl-3,5-dimethylphenyl)acetamide (PubChem CID 86632821) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-formyl-3,5-dimethylphenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-formyl-3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 86632821 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-formyl-3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)C(F)(F)F)cc(C)c1C=O |
| InChI | InChI=1S/C11H10F3NO2/c1-6-3-8(4-7(2)9(6)5-16)15-10(17)11(12,13)14/h3-5H,1-2H3,(H,15,17) |
| InChIKey | WOHWAQUBJIXUKF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|