C13H12BrF6NO — CID 71672512
2-bromo-3,3,3-trifluoro-2-(trifluoromethyl)-N-(3,4,5-trimethylphenyl)propanamide (PubChem CID 71672512) has the molecular formula C13H12BrF6NO and a molecular weight of 392.14 g/mol. Its IUPAC name is 2-bromo-3,3,3-trifluoro-2-(trifluoromethyl)-N-(3,4,5-trimethylphenyl)propanamide.
| Compound Name | 2-bromo-3,3,3-trifluoro-2-(trifluoromethyl)-N-(3,4,5-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 71672512 |
| Molecular Formula | C13H12BrF6NO |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 2-bromo-3,3,3-trifluoro-2-(trifluoromethyl)-N-(3,4,5-trimethylphenyl)propanamide |
| SMILES | Cc1cc(NC(=O)C(Br)(C(F)(F)F)C(F)(F)F)cc(C)c1C |
| InChI | InChI=1S/C13H12BrF6NO/c1-6-4-9(5-7(2)8(6)3)21-10(22)11(14,12(15,16)17)13(18,19)20/h4-5H,1-3H3,(H,21,22) |
| InChIKey | ZBOHEXOPVRSDTO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|