C10H8F3NO — CID 11127643
N-(2-ethenylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 11127643) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is N-(2-ethenylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-ethenylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11127643 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-(2-ethenylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | C=Cc1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO/c1-2-7-5-3-4-6-8(7)14-9(15)10(11,12)13/h2-6H,1H2,(H,14,15) |
| InChIKey | BHSJBTZNWUGPPW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |