C10H5BrF3N3O — CID 11244107
N-(3-bromoquinoxalin-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 11244107) has the molecular formula C10H5BrF3N3O and a molecular weight of 320.07 g/mol. Its IUPAC name is N-(3-bromoquinoxalin-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-bromoquinoxalin-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11244107 |
| Molecular Formula | C10H5BrF3N3O |
| Molecular Weight | 320.07 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | N-(3-bromoquinoxalin-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1nc2ccccc2nc1Br)C(F)(F)F |
| InChI | InChI=1S/C10H5BrF3N3O/c11-7-8(17-9(18)10(12,13)14)16-6-4-2-1-3-5(6)15-7/h1-4H,(H,16,17,18) |
| InChIKey | BESFSBVNFJHXNP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.07 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |