About potassium;benzoic acid;2-methylpropane
potassium;benzoic acid;2-methylpropane (PubChem CID 118589563) has the molecular formula C11H15KO2
and a molecular weight of 218.34 g/mol. Its IUPAC name is potassium;benzoic acid;2-methylpropane.
Molecular Properties
| Compound Name | potassium;benzoic acid;2-methylpropane |
| PubChem CID | 118589563 |
| Molecular Formula | C11H15KO2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | potassium;benzoic acid;2-methylpropane |
| SMILES | C[C-](C)C.O=C(O)c1ccccc1.[K+] |
| InChI | InChI=1S/C7H6O2.C4H9.K/c8-7(9)6-4-2-1-3-5-6;1-4(2)3;/h1-5H,(H,8,9);1-3H3;/q;-1;+1 |
| InChIKey | NXLVJODKIIWTHT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;benzoic acid;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;benzoic acid;2-methylpropane?
The IUPAC name of potassium;benzoic acid;2-methylpropane (CID 118589563) is potassium;benzoic acid;2-methylpropane.
What is the SMILES notation for potassium;benzoic acid;2-methylpropane?
The canonical SMILES for potassium;benzoic acid;2-methylpropane is C[C-](C)C.O=C(O)c1ccccc1.[K+].
What is the InChIKey of potassium;benzoic acid;2-methylpropane?
The InChIKey is NXLVJODKIIWTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C4H9.K/c8-7(9)6-4-2-1-3-5-6;1-4(2)3;/h1-5H,(H,8,9);1-3H3;/q;-1;+1.
What are the key properties of potassium;benzoic acid;2-methylpropane?
potassium;benzoic acid;2-methylpropane has a molecular weight of 218.34 g/mol, XLogP of 0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;benzoic acid;2-methylpropane is sourced from PubChem (CID 118589563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).