About dilithium;oct-4-en-4-ylbenzene
dilithium;oct-4-en-4-ylbenzene (PubChem CID 177428375) has the molecular formula C14H18Li2
and a molecular weight of 200.18 g/mol. Its IUPAC name is dilithium;oct-4-en-4-ylbenzene.
Molecular Properties
| Compound Name | dilithium;oct-4-en-4-ylbenzene |
| PubChem CID | 177428375 |
| Molecular Formula | C14H18Li2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | dilithium;oct-4-en-4-ylbenzene |
| SMILES | CCC/[C-]=C(\CCC)c1[c-]cccc1.[Li+].[Li+] |
| InChI | InChI=1S/C14H18.2Li/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14;;/h6-8,11H,3-5,9H2,1-2H3;;/q-2;2*+1 |
| InChIKey | QWAHQLYHYWSPJK-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;oct-4-en-4-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;oct-4-en-4-ylbenzene?
The IUPAC name of dilithium;oct-4-en-4-ylbenzene (CID 177428375) is dilithium;oct-4-en-4-ylbenzene.
What is the SMILES notation for dilithium;oct-4-en-4-ylbenzene?
The canonical SMILES for dilithium;oct-4-en-4-ylbenzene is CCC/[C-]=C(\CCC)c1[c-]cccc1.[Li+].[Li+].
What is the InChIKey of dilithium;oct-4-en-4-ylbenzene?
The InChIKey is QWAHQLYHYWSPJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18.2Li/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14;;/h6-8,11H,3-5,9H2,1-2H3;;/q-2;2*+1.
What are the key properties of dilithium;oct-4-en-4-ylbenzene?
dilithium;oct-4-en-4-ylbenzene has a molecular weight of 200.18 g/mol, XLogP of -1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;oct-4-en-4-ylbenzene is sourced from PubChem (CID 177428375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).