C32H44Zr+2 — CID 23004392
bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) (PubChem CID 23004392) has the molecular formula C32H44Zr+2 and a molecular weight of 519.93 g/mol. Its IUPAC name is bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+).
| Compound Name | bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) |
|---|---|
| PubChem CID | 23004392 |
| Molecular Formula | C32H44Zr+2 |
| Molecular Weight | 519.93 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) |
| SMILES | C1CCCC1.C1CCCC1.CCC/[C-]=C(CCC)/C(=[C-]/c1ccccc1)c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C22H24.2C5H10.Zr/c1-3-5-15-20(12-4-2)22(21-16-10-7-11-17-21)18-19-13-8-6-9-14-19;2*1-2-4-5-3-1;/h6-11,13-14,16-17H,3-5,12H2,1-2H3;2*1-5H2;/q-2;;;+4 |
| InChIKey | XQESIXLGKJQYNF-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.93 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|