About bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+)
bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) (PubChem CID 23004392) has the molecular formula C32H44Zr+2
and a molecular weight of 519.93 g/mol. Its IUPAC name is bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+).
Molecular Properties
| Compound Name | bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) |
| PubChem CID | 23004392 |
| Molecular Formula | C32H44Zr+2 |
| Molecular Weight | 519.93 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) |
| SMILES | C1CCCC1.C1CCCC1.CCC/[C-]=C(CCC)/C(=[C-]/c1ccccc1)c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C22H24.2C5H10.Zr/c1-3-5-15-20(12-4-2)22(21-16-10-7-11-17-21)18-19-13-8-6-9-14-19;2*1-2-4-5-3-1;/h6-11,13-14,16-17H,3-5,12H2,1-2H3;2*1-5H2;/q-2;;;+4 |
| InChIKey | XQESIXLGKJQYNF-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.93 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+)?
The IUPAC name of bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) (CID 23004392) is bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+).
What is the SMILES notation for bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+)?
The canonical SMILES for bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) is C1CCCC1.C1CCCC1.CCC/[C-]=C(CCC)/C(=[C-]/c1ccccc1)c1ccccc1.[Zr+4].
What is the InChIKey of bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+)?
The InChIKey is XQESIXLGKJQYNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24.2C5H10.Zr/c1-3-5-15-20(12-4-2)22(21-16-10-7-11-17-21)18-19-13-8-6-9-14-19;2*1-2-4-5-3-1;/h6-11,13-14,16-17H,3-5,12H2,1-2H3;2*1-5H2;/q-2;;;+4.
What are the key properties of bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+)?
bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) has a molecular weight of 519.93 g/mol, XLogP of 10.15, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopentane);(1-phenyl-3-propylhepta-1,3-dien-2-yl)benzene;zirconium(4+) is sourced from PubChem (CID 23004392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).