About CID 11733130
CID 11733130 (PubChem CID 11733130) has the molecular formula C28H26Zr+2
and a molecular weight of 453.74 g/mol.
Molecular Properties
| Compound Name | CID 11733130 |
| PubChem CID | 11733130 |
| Molecular Formula | C28H26Zr+2 |
| Molecular Weight | 453.74 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | — |
| SMILES | C/[C-]=C(C)/C(=[C-]/c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Zr+4] |
| InChI | InChI=1S/C18H16.2C5H5.Zr/c1-3-15(2)18(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16;2*1-2-4-5-3-1;/h4-13H,1-2H3;2*1-5H;/q-2;;;+4 |
| InChIKey | MTAXBLVDYLEAGF-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.74 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 11733130 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11733130?
The IUPAC name of CID 11733130 (CID 11733130) is not available.
What is the SMILES notation for CID 11733130?
The canonical SMILES for CID 11733130 is C/[C-]=C(C)/C(=[C-]/c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Zr+4].
What is the InChIKey of CID 11733130?
The InChIKey is MTAXBLVDYLEAGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16.2C5H5.Zr/c1-3-15(2)18(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16;2*1-2-4-5-3-1;/h4-13H,1-2H3;2*1-5H;/q-2;;;+4.
What are the key properties of CID 11733130?
CID 11733130 has a molecular weight of 453.74 g/mol, XLogP of 6.73, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11733130 is sourced from PubChem (CID 11733130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).