About 1-phenylethaneselone
1-phenylethaneselone (PubChem CID 21319756) has the molecular formula C8H8Se
and a molecular weight of 183.11 g/mol. Its IUPAC name is 1-phenylethaneselone.
Molecular Properties
| Compound Name | 1-phenylethaneselone |
| PubChem CID | 21319756 |
| Molecular Formula | C8H8Se |
| Molecular Weight | 183.11 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 1-phenylethaneselone |
| SMILES | CC(=[Se])c1ccccc1 |
| InChI | InChI=1S/C8H8Se/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | ADENURIBLSPVCD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethaneselone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethaneselone?
The IUPAC name of 1-phenylethaneselone (CID 21319756) is 1-phenylethaneselone.
What is the SMILES notation for 1-phenylethaneselone?
The canonical SMILES for 1-phenylethaneselone is CC(=[Se])c1ccccc1.
What is the InChIKey of 1-phenylethaneselone?
The InChIKey is ADENURIBLSPVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Se/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 1-phenylethaneselone?
1-phenylethaneselone has a molecular weight of 183.11 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethaneselone is sourced from PubChem (CID 21319756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).