About 1-phenylethylideneazanide;ruthenium(1+)
1-phenylethylideneazanide;ruthenium(1+) (PubChem CID 59356813) has the molecular formula C8H8NRu
and a molecular weight of 219.23 g/mol. Its IUPAC name is 1-phenylethylideneazanide;ruthenium(1+).
Molecular Properties
| Compound Name | 1-phenylethylideneazanide;ruthenium(1+) |
| PubChem CID | 59356813 |
| Molecular Formula | C8H8NRu |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 1-phenylethylideneazanide;ruthenium(1+) |
| SMILES | CC(=[N-])c1ccccc1.[Ru+] |
| InChI | InChI=1S/C8H8N.Ru/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H3;/q-1;+1 |
| InChIKey | JSKCXVAXYWXCJD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethylideneazanide;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethylideneazanide;ruthenium(1+)?
The IUPAC name of 1-phenylethylideneazanide;ruthenium(1+) (CID 59356813) is 1-phenylethylideneazanide;ruthenium(1+).
What is the SMILES notation for 1-phenylethylideneazanide;ruthenium(1+)?
The canonical SMILES for 1-phenylethylideneazanide;ruthenium(1+) is CC(=[N-])c1ccccc1.[Ru+].
What is the InChIKey of 1-phenylethylideneazanide;ruthenium(1+)?
The InChIKey is JSKCXVAXYWXCJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N.Ru/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H3;/q-1;+1.
What are the key properties of 1-phenylethylideneazanide;ruthenium(1+)?
1-phenylethylideneazanide;ruthenium(1+) has a molecular weight of 219.23 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethylideneazanide;ruthenium(1+) is sourced from PubChem (CID 59356813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).