About CID 136814237
CID 136814237 (PubChem CID 136814237) has the molecular formula C7H5Se2
and a molecular weight of 247.04 g/mol.
Molecular Properties
| Compound Name | CID 136814237 |
| PubChem CID | 136814237 |
| Molecular Formula | C7H5Se2 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 248.87 |
| IUPAC Name | — |
| SMILES | [Se]C(=[Se])c1ccccc1 |
| InChI | InChI=1S/C7H5Se2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| InChIKey | GLDFJGVNVMNQES-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136814237 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136814237?
The IUPAC name of CID 136814237 (CID 136814237) is not available.
What is the SMILES notation for CID 136814237?
The canonical SMILES for CID 136814237 is [Se]C(=[Se])c1ccccc1.
What is the InChIKey of CID 136814237?
The InChIKey is GLDFJGVNVMNQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Se2/c8-7(9)6-4-2-1-3-5-6/h1-5H.
What are the key properties of CID 136814237?
CID 136814237 has a molecular weight of 247.04 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136814237 is sourced from PubChem (CID 136814237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).