About N,N-dimethylbenzamide;iodozinc(1+)
N,N-dimethylbenzamide;iodozinc(1+) (PubChem CID 15739812) has the molecular formula C9H10INOZn
and a molecular weight of 340.48 g/mol. Its IUPAC name is N,N-dimethylbenzamide;iodozinc(1+).
Molecular Properties
| Compound Name | N,N-dimethylbenzamide;iodozinc(1+) |
| PubChem CID | 15739812 |
| Molecular Formula | C9H10INOZn |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | N,N-dimethylbenzamide;iodozinc(1+) |
| SMILES | CN(C)C(=O)c1[c-]cccc1.[Zn+]I |
| InChI | InChI=1S/C9H10NO.HI.Zn/c1-10(2)9(11)8-6-4-3-5-7-8;;/h3-6H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | DSSDFYWUACWAHI-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylbenzamide;iodozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylbenzamide;iodozinc(1+)?
The IUPAC name of N,N-dimethylbenzamide;iodozinc(1+) (CID 15739812) is N,N-dimethylbenzamide;iodozinc(1+).
What is the SMILES notation for N,N-dimethylbenzamide;iodozinc(1+)?
The canonical SMILES for N,N-dimethylbenzamide;iodozinc(1+) is CN(C)C(=O)c1[c-]cccc1.[Zn+]I.
What is the InChIKey of N,N-dimethylbenzamide;iodozinc(1+)?
The InChIKey is DSSDFYWUACWAHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10NO.HI.Zn/c1-10(2)9(11)8-6-4-3-5-7-8;;/h3-6H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of N,N-dimethylbenzamide;iodozinc(1+)?
N,N-dimethylbenzamide;iodozinc(1+) has a molecular weight of 340.48 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylbenzamide;iodozinc(1+) is sourced from PubChem (CID 15739812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).