C20H14N2O2 — CID 71367616
4-[(2-methoxynaphthalen-1-yl)methoxy]benzene-1,2-dicarbonitrile (PubChem CID 71367616) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[(2-methoxynaphthalen-1-yl)methoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2-methoxynaphthalen-1-yl)methoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 71367616 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-[(2-methoxynaphthalen-1-yl)methoxy]benzene-1,2-dicarbonitrile |
| SMILES | COc1ccc2ccccc2c1COc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C20H14N2O2/c1-23-20-9-7-14-4-2-3-5-18(14)19(20)13-24-17-8-6-15(11-21)16(10-17)12-22/h2-10H,13H2,1H3 |
| InChIKey | PTXXKBULKCJOTR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |