C10H12F3NO — CID 164885137
[3-(2,2-difluoropropoxy)-5-fluorophenyl]methanamine (PubChem CID 164885137) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is [3-(2,2-difluoropropoxy)-5-fluorophenyl]methanamine.
| Compound Name | [3-(2,2-difluoropropoxy)-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 164885137 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | [3-(2,2-difluoropropoxy)-5-fluorophenyl]methanamine |
| SMILES | CC(F)(F)COc1cc(F)cc(CN)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-10(12,13)6-15-9-3-7(5-14)2-8(11)4-9/h2-4H,5-6,14H2,1H3 |
| InChIKey | YRQOADFEKUVUNA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |