C10H11F4NO2 — CID 106704805
[3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)phenyl]methanamine (PubChem CID 106704805) has the molecular formula C10H11F4NO2 and a molecular weight of 253.19 g/mol. Its IUPAC name is [3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)phenyl]methanamine.
| Compound Name | [3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 106704805 |
| Molecular Formula | C10H11F4NO2 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | [3-fluoro-5-(2,2,2-trifluoroethoxymethoxy)phenyl]methanamine |
| SMILES | NCc1cc(F)cc(OCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F4NO2/c11-8-1-7(4-15)2-9(3-8)17-6-16-5-10(12,13)14/h1-3H,4-6,15H2 |
| InChIKey | KYZDRKCYUAJZQI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|