C12H13BrF5NO — CID 103475087
1-(2-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475087) has the molecular formula C12H13BrF5NO and a molecular weight of 362.14 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475087 |
| Molecular Formula | C12H13BrF5NO |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | NC(COCC(F)(F)C(F)F)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C12H13BrF5NO/c13-10-2-1-8(14)3-7(10)4-9(19)5-20-6-12(17,18)11(15)16/h1-3,9,11H,4-6,19H2 |
| InChIKey | VXYZOFYTTCCXLO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|