C13H15BrF5NO — CID 103475480
1-(3-bromo-4-fluorophenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475480) has the molecular formula C13H15BrF5NO and a molecular weight of 376.16 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475480 |
| Molecular Formula | C13H15BrF5NO |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CNC(COCC(F)(F)C(F)F)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H15BrF5NO/c1-20-9(6-21-7-13(18,19)12(16)17)4-8-2-3-11(15)10(14)5-8/h2-3,5,9,12,20H,4,6-7H2,1H3 |
| InChIKey | FTHBEPIFEKBBGY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|