C13H19BrFNO — CID 105111283
1-(3-bromo-4-fluorophenyl)-N-methyl-3-propan-2-yloxypropan-2-amine (PubChem CID 105111283) has the molecular formula C13H19BrFNO and a molecular weight of 304.20 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-N-methyl-3-propan-2-yloxypropan-2-amine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-N-methyl-3-propan-2-yloxypropan-2-amine |
|---|---|
| PubChem CID | 105111283 |
| Molecular Formula | C13H19BrFNO |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-N-methyl-3-propan-2-yloxypropan-2-amine |
| SMILES | CNC(COC(C)C)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H19BrFNO/c1-9(2)17-8-11(16-3)6-10-4-5-13(15)12(14)7-10/h4-5,7,9,11,16H,6,8H2,1-3H3 |
| InChIKey | PNUFIFFNNFFWBS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |