C17H27BrFN — CID 115818913
1-(3-bromo-4-fluorophenyl)-N,4,6,6-tetramethylheptan-2-amine (PubChem CID 115818913) has the molecular formula C17H27BrFN and a molecular weight of 344.31 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-N,4,6,6-tetramethylheptan-2-amine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-N,4,6,6-tetramethylheptan-2-amine |
|---|---|
| PubChem CID | 115818913 |
| Molecular Formula | C17H27BrFN |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-N,4,6,6-tetramethylheptan-2-amine |
| SMILES | CNC(Cc1ccc(F)c(Br)c1)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H27BrFN/c1-12(11-17(2,3)4)8-14(20-5)9-13-6-7-16(19)15(18)10-13/h6-7,10,12,14,20H,8-9,11H2,1-5H3 |
| InChIKey | YORKYCHRDQPCCH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |