C12H15BrF4N2O — CID 103475568
1-(5-bromo-3-pyridinyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475568) has the molecular formula C12H15BrF4N2O and a molecular weight of 359.16 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475568 |
| Molecular Formula | C12H15BrF4N2O |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CNC(COCC(F)(F)C(F)F)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C12H15BrF4N2O/c1-18-10(3-8-2-9(13)5-19-4-8)6-20-7-12(16,17)11(14)15/h2,4-5,10-11,18H,3,6-7H2,1H3 |
| InChIKey | HETAWPLKKPHGPA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|