C14H20BrF3N2O — CID 103148756
1-(5-bromo-3-pyridinyl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103148756) has the molecular formula C14H20BrF3N2O and a molecular weight of 369.23 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148756 |
| Molecular Formula | C14H20BrF3N2O |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-N-propyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | CCCNC(CCOCC(F)(F)F)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C14H20BrF3N2O/c1-2-4-20-13(3-5-21-10-14(16,17)18)7-11-6-12(15)9-19-8-11/h6,8-9,13,20H,2-5,7,10H2,1H3 |
| InChIKey | NGQWGHSBFBPYKF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|