C12H20BrN3O — CID 105334758
[1-(5-bromo-3-pyridinyl)-4-propoxybutan-2-yl]hydrazine (PubChem CID 105334758) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is [1-(5-bromo-3-pyridinyl)-4-propoxybutan-2-yl]hydrazine.
| Compound Name | [1-(5-bromo-3-pyridinyl)-4-propoxybutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105334758 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [1-(5-bromo-3-pyridinyl)-4-propoxybutan-2-yl]hydrazine |
| SMILES | CCCOCCC(Cc1cncc(Br)c1)NN |
| InChI | InChI=1S/C12H20BrN3O/c1-2-4-17-5-3-12(16-14)7-10-6-11(13)9-15-8-10/h6,8-9,12,16H,2-5,7,14H2,1H3 |
| InChIKey | PAGKLHZBGZWUMB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|