C9H14BrN3 — CID 105200907
1-(5-bromo-3-pyridinyl)butan-2-ylhydrazine (PubChem CID 105200907) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)butan-2-ylhydrazine.
| Compound Name | 1-(5-bromo-3-pyridinyl)butan-2-ylhydrazine |
|---|---|
| PubChem CID | 105200907 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)butan-2-ylhydrazine |
| SMILES | CCC(Cc1cncc(Br)c1)NN |
| InChI | InChI=1S/C9H14BrN3/c1-2-9(13-11)4-7-3-8(10)6-12-5-7/h3,5-6,9,13H,2,4,11H2,1H3 |
| InChIKey | IBFNSHYNPLRRNU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|