C14H23BrN2O2 — CID 102928454
1-(5-bromo-3-pyridinyl)-N-ethyl-4-(2-methoxyethoxy)butan-2-amine (PubChem CID 102928454) has the molecular formula C14H23BrN2O2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-N-ethyl-4-(2-methoxyethoxy)butan-2-amine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-N-ethyl-4-(2-methoxyethoxy)butan-2-amine |
|---|---|
| PubChem CID | 102928454 |
| Molecular Formula | C14H23BrN2O2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-N-ethyl-4-(2-methoxyethoxy)butan-2-amine |
| SMILES | CCNC(CCOCCOC)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C14H23BrN2O2/c1-3-17-14(4-5-19-7-6-18-2)9-12-8-13(15)11-16-10-12/h8,10-11,14,17H,3-7,9H2,1-2H3 |
| InChIKey | KRFNHZPOFXQZLX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|