C10H14BrFN2 — CID 130589548
4-(5-bromo-3-pyridinyl)-3-fluoro-2-methylbutan-2-amine (PubChem CID 130589548) has the molecular formula C10H14BrFN2 and a molecular weight of 261.14 g/mol. Its IUPAC name is 4-(5-bromo-3-pyridinyl)-3-fluoro-2-methylbutan-2-amine.
| Compound Name | 4-(5-bromo-3-pyridinyl)-3-fluoro-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 130589548 |
| Molecular Formula | C10H14BrFN2 |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-(5-bromo-3-pyridinyl)-3-fluoro-2-methylbutan-2-amine |
| SMILES | CC(C)(N)C(F)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C10H14BrFN2/c1-10(2,13)9(12)4-7-3-8(11)6-14-5-7/h3,5-6,9H,4,13H2,1-2H3 |
| InChIKey | MMPKVGBPVPLUMR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |