About 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine
3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine (PubChem CID 103517071) has the molecular formula C8H12ClF2N3
and a molecular weight of 223.65 g/mol. Its IUPAC name is 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine.
Molecular Properties
| Compound Name | 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine |
| PubChem CID | 103517071 |
| Molecular Formula | C8H12ClF2N3 |
| Molecular Weight | 223.65 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine |
| SMILES | Cc1nn(C)c(Cl)c1CC(N)C(F)F |
| InChI | InChI=1S/C8H12ClF2N3/c1-4-5(3-6(12)8(10)11)7(9)14(2)13-4/h6,8H,3,12H2,1-2H3 |
| InChIKey | TUSZDRFEJCLCIH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.65 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine?
The IUPAC name of 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine (CID 103517071) is 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine.
What is the SMILES notation for 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine?
The canonical SMILES for 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine is Cc1nn(C)c(Cl)c1CC(N)C(F)F.
What is the InChIKey of 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine?
The InChIKey is TUSZDRFEJCLCIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClF2N3/c1-4-5(3-6(12)8(10)11)7(9)14(2)13-4/h6,8H,3,12H2,1-2H3.
What are the key properties of 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine?
3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine has a molecular weight of 223.65 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1,1-difluoropropan-2-amine is sourced from PubChem (CID 103517071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).