C16H30ClN3O — CID 116719549
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methoxy-N-propylhexan-2-amine (PubChem CID 116719549) has the molecular formula C16H30ClN3O and a molecular weight of 315.89 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methoxy-N-propylhexan-2-amine.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methoxy-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 116719549 |
| Molecular Formula | C16H30ClN3O |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methoxy-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1c(Cl)c(CC)nn1C)C(CCC)OC |
| InChI | InChI=1S/C16H30ClN3O/c1-6-9-15(21-5)13(18-10-7-2)11-14-16(17)12(8-3)19-20(14)4/h13,15,18H,6-11H2,1-5H3 |
| InChIKey | UPTLJMZKVRTGBV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |