C11H19ClN2O — CID 66060491
2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]butan-1-ol (PubChem CID 66060491) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]butan-1-ol.
| Compound Name | 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 66060491 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]butan-1-ol |
| SMILES | CCC(CO)Cc1c(Cl)c(C)nn1CC |
| InChI | InChI=1S/C11H19ClN2O/c1-4-9(7-15)6-10-11(12)8(3)13-14(10)5-2/h9,15H,4-7H2,1-3H3 |
| InChIKey | RQYWKSBAOUUKSR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |