C16H19Cl3N2 — CID 66035055
4-chloro-5-[2-(chloromethyl)-3-(4-chlorophenyl)propyl]-1-ethyl-3-methylpyrazole (PubChem CID 66035055) has the molecular formula C16H19Cl3N2 and a molecular weight of 345.70 g/mol. Its IUPAC name is 4-chloro-5-[2-(chloromethyl)-3-(4-chlorophenyl)propyl]-1-ethyl-3-methylpyrazole.
| Compound Name | 4-chloro-5-[2-(chloromethyl)-3-(4-chlorophenyl)propyl]-1-ethyl-3-methylpyrazole |
|---|---|
| PubChem CID | 66035055 |
| Molecular Formula | C16H19Cl3N2 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-chloro-5-[2-(chloromethyl)-3-(4-chlorophenyl)propyl]-1-ethyl-3-methylpyrazole |
| SMILES | CCn1nc(C)c(Cl)c1CC(CCl)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19Cl3N2/c1-3-21-15(16(19)11(2)20-21)9-13(10-17)8-12-4-6-14(18)7-5-12/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | JUTAKDAMUZPPKF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|