C16H19Br2ClN2 — CID 66040753
5-[2-(bromomethyl)-3-(2-bromophenyl)propyl]-4-chloro-1-ethyl-3-methylpyrazole (PubChem CID 66040753) has the molecular formula C16H19Br2ClN2 and a molecular weight of 434.60 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3-(2-bromophenyl)propyl]-4-chloro-1-ethyl-3-methylpyrazole.
| Compound Name | 5-[2-(bromomethyl)-3-(2-bromophenyl)propyl]-4-chloro-1-ethyl-3-methylpyrazole |
|---|---|
| PubChem CID | 66040753 |
| Molecular Formula | C16H19Br2ClN2 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | 5-[2-(bromomethyl)-3-(2-bromophenyl)propyl]-4-chloro-1-ethyl-3-methylpyrazole |
| SMILES | CCn1nc(C)c(Cl)c1CC(CBr)Cc1ccccc1Br |
| InChI | InChI=1S/C16H19Br2ClN2/c1-3-21-15(16(19)11(2)20-21)9-12(10-17)8-13-6-4-5-7-14(13)18/h4-7,12H,3,8-10H2,1-2H3 |
| InChIKey | IYMPHWLSGVZLMT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|