C15H27ClN4 — CID 79056546
1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-pyrrolidin-1-ylbutan-2-amine (PubChem CID 79056546) has the molecular formula C15H27ClN4 and a molecular weight of 298.86 g/mol. Its IUPAC name is 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-pyrrolidin-1-ylbutan-2-amine.
| Compound Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-pyrrolidin-1-ylbutan-2-amine |
|---|---|
| PubChem CID | 79056546 |
| Molecular Formula | C15H27ClN4 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-pyrrolidin-1-ylbutan-2-amine |
| SMILES | CCn1nc(C)c(Cl)c1CC(N)C(C)(C)N1CCCC1 |
| InChI | InChI=1S/C15H27ClN4/c1-5-20-12(14(16)11(2)18-20)10-13(17)15(3,4)19-8-6-7-9-19/h13H,5-10,17H2,1-4H3 |
| InChIKey | IMSRGQBFBIXWHY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |