C12H12O3S2 — CID 66436704
4-[(5-ethylthiophen-2-yl)methoxy]thiophene-2-carboxylic acid (PubChem CID 66436704) has the molecular formula C12H12O3S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[(5-ethylthiophen-2-yl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-ethylthiophen-2-yl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66436704 |
| Molecular Formula | C12H12O3S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-[(5-ethylthiophen-2-yl)methoxy]thiophene-2-carboxylic acid |
| SMILES | CCc1ccc(COc2csc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C12H12O3S2/c1-2-9-3-4-10(17-9)6-15-8-5-11(12(13)14)16-7-8/h3-5,7H,2,6H2,1H3,(H,13,14) |
| InChIKey | CFUZKHDRNSKUOY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |