C12H12O2S3 — CID 79150186
4-[(5-ethylthiophen-2-yl)methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 79150186) has the molecular formula C12H12O2S3 and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-[(5-ethylthiophen-2-yl)methylsulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-ethylthiophen-2-yl)methylsulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79150186 |
| Molecular Formula | C12H12O2S3 |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 4-[(5-ethylthiophen-2-yl)methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | CCc1ccc(CSc2csc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C12H12O2S3/c1-2-8-3-4-9(17-8)6-15-10-5-11(12(13)14)16-7-10/h3-5,7H,2,6H2,1H3,(H,13,14) |
| InChIKey | SZUAACGLTYBDIT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |