C15H16O2S2 — CID 64926971
2-[4-[(5-ethylthiophen-2-yl)methylsulfanyl]phenyl]acetic acid (PubChem CID 64926971) has the molecular formula C15H16O2S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-[4-[(5-ethylthiophen-2-yl)methylsulfanyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(5-ethylthiophen-2-yl)methylsulfanyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 64926971 |
| Molecular Formula | C15H16O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[4-[(5-ethylthiophen-2-yl)methylsulfanyl]phenyl]acetic acid |
| SMILES | CCc1ccc(CSc2ccc(CC(=O)O)cc2)s1 |
| InChI | InChI=1S/C15H16O2S2/c1-2-12-7-8-14(19-12)10-18-13-5-3-11(4-6-13)9-15(16)17/h3-8H,2,9-10H2,1H3,(H,16,17) |
| InChIKey | YAUWVDCIMFWMTN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |