C13H11BrO3S2 — CID 79139067
4-[(5-bromo-2-methoxyphenyl)methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 79139067) has the molecular formula C13H11BrO3S2 and a molecular weight of 359.27 g/mol. Its IUPAC name is 4-[(5-bromo-2-methoxyphenyl)methylsulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-bromo-2-methoxyphenyl)methylsulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79139067 |
| Molecular Formula | C13H11BrO3S2 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 4-[(5-bromo-2-methoxyphenyl)methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | COc1ccc(Br)cc1CSc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C13H11BrO3S2/c1-17-11-3-2-9(14)4-8(11)6-18-10-5-12(13(15)16)19-7-10/h2-5,7H,6H2,1H3,(H,15,16) |
| InChIKey | ZRLKLNMRPGNCNZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |