C15H12Br2O3S — CID 115382068
4-bromo-2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]benzoic acid (PubChem CID 115382068) has the molecular formula C15H12Br2O3S and a molecular weight of 432.13 g/mol. Its IUPAC name is 4-bromo-2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]benzoic acid.
| Compound Name | 4-bromo-2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 115382068 |
| Molecular Formula | C15H12Br2O3S |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 429.89 |
| IUPAC Name | 4-bromo-2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]benzoic acid |
| SMILES | COc1ccc(Br)cc1CSc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C15H12Br2O3S/c1-20-13-5-3-10(16)6-9(13)8-21-14-7-11(17)2-4-12(14)15(18)19/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | PCQSWLWDNDKPDK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |