C12H15BrO3S — CID 105353057
2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]butanoic acid (PubChem CID 105353057) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]butanoic acid.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 105353057 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]butanoic acid |
| SMILES | CCC(SCc1cc(Br)ccc1OC)C(=O)O |
| InChI | InChI=1S/C12H15BrO3S/c1-3-11(12(14)15)17-7-8-6-9(13)4-5-10(8)16-2/h4-6,11H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | LZEIEZPQJVKWCU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |