C11H13BrO3S — CID 60666746
2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]propanoic acid (PubChem CID 60666746) has the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]propanoic acid.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 60666746 |
| Molecular Formula | C11H13BrO3S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methylsulfanyl]propanoic acid |
| SMILES | COc1ccc(Br)cc1CSC(C)C(=O)O |
| InChI | InChI=1S/C11H13BrO3S/c1-7(11(13)14)16-6-8-5-9(12)3-4-10(8)15-2/h3-5,7H,6H2,1-2H3,(H,13,14) |
| InChIKey | GDNWWHAUEJCKNZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |