C14H16FNO2S — CID 86919580
2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-prop-2-ynylpropanamide (PubChem CID 86919580) has the molecular formula C14H16FNO2S and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 86919580 |
| Molecular Formula | C14H16FNO2S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)SCc1cc(F)ccc1OC |
| InChI | InChI=1S/C14H16FNO2S/c1-4-7-16-14(17)10(2)19-9-11-8-12(15)5-6-13(11)18-3/h1,5-6,8,10H,7,9H2,2-3H3,(H,16,17) |
| InChIKey | VCBMCPYOSHGDIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|