C11H12BrNO3S — CID 115381842
4-bromo-2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 115381842) has the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. Its IUPAC name is 4-bromo-2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 4-bromo-2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 115381842 |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 4-bromo-2-[2-(dimethylamino)-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | CN(C)C(=O)CSc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C11H12BrNO3S/c1-13(2)10(14)6-17-9-5-7(12)3-4-8(9)11(15)16/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | UYLZOQZLOKSGCI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |