C13H13BrN2O4S — CID 115381756
4-bromo-2-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]sulfanylbenzoic acid (PubChem CID 115381756) has the molecular formula C13H13BrN2O4S and a molecular weight of 373.23 g/mol. Its IUPAC name is 4-bromo-2-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]sulfanylbenzoic acid.
| Compound Name | 4-bromo-2-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 115381756 |
| Molecular Formula | C13H13BrN2O4S |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 4-bromo-2-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]sulfanylbenzoic acid |
| SMILES | C=CCNC(=O)NC(=O)CSc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C13H13BrN2O4S/c1-2-5-15-13(20)16-11(17)7-21-10-6-8(14)3-4-9(10)12(18)19/h2-4,6H,1,5,7H2,(H,18,19)(H2,15,16,17,20) |
| InChIKey | COGQURCTCQFPCQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|