C14H16BrNO4S — CID 115382047
4-bromo-2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanylbenzoic acid (PubChem CID 115382047) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 4-bromo-2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanylbenzoic acid.
| Compound Name | 4-bromo-2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 115382047 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 4-bromo-2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanylbenzoic acid |
| SMILES | O=C(CSc1cc(Br)ccc1C(=O)O)NCC1CCCO1 |
| InChI | InChI=1S/C14H16BrNO4S/c15-9-3-4-11(14(18)19)12(6-9)21-8-13(17)16-7-10-2-1-5-20-10/h3-4,6,10H,1-2,5,7-8H2,(H,16,17)(H,18,19) |
| InChIKey | KJECTBAXHSTCDG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |