C15H15BrN2O4 — CID 2978035
2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 2978035) has the molecular formula C15H15BrN2O4 and a molecular weight of 367.20 g/mol. Its IUPAC name is 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2978035 |
| Molecular Formula | C15H15BrN2O4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccc(Br)cc2C1=O)NCC1CCCO1 |
| InChI | InChI=1S/C15H15BrN2O4/c16-9-3-4-11-12(6-9)15(21)18(14(11)20)8-13(19)17-7-10-2-1-5-22-10/h3-4,6,10H,1-2,5,7-8H2,(H,17,19) |
| InChIKey | TYOUVQLTBPZBAT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|