C20H21BrN2O3S — CID 46616572
2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 46616572) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is 2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46616572 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CSc1ccc(Br)cc1)Nc1ccccc1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C20H21BrN2O3S/c21-14-7-9-16(10-8-14)27-13-19(24)23-18-6-2-1-5-17(18)20(25)22-12-15-4-3-11-26-15/h1-2,5-10,15H,3-4,11-13H2,(H,22,25)(H,23,24) |
| InChIKey | VHRSRATZSBKNFQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |