C10H7BrO2S3 — CID 79139567
4-[(5-bromothiophen-3-yl)methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 79139567) has the molecular formula C10H7BrO2S3 and a molecular weight of 335.27 g/mol. Its IUPAC name is 4-[(5-bromothiophen-3-yl)methylsulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-bromothiophen-3-yl)methylsulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79139567 |
| Molecular Formula | C10H7BrO2S3 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 333.88 |
| IUPAC Name | 4-[(5-bromothiophen-3-yl)methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SCc2csc(Br)c2)cs1 |
| InChI | InChI=1S/C10H7BrO2S3/c11-9-1-6(4-16-9)3-14-7-2-8(10(12)13)15-5-7/h1-2,4-5H,3H2,(H,12,13) |
| InChIKey | HUPHQMBLKRKDDR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |