C12H5F5O2S2 — CID 79132461
4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 79132461) has the molecular formula C12H5F5O2S2 and a molecular weight of 340.29 g/mol. Its IUPAC name is 4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79132461 |
| Molecular Formula | C12H5F5O2S2 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SCc2c(F)c(F)c(F)c(F)c2F)cs1 |
| InChI | InChI=1S/C12H5F5O2S2/c13-7-5(8(14)10(16)11(17)9(7)15)3-20-4-1-6(12(18)19)21-2-4/h1-2H,3H2,(H,18,19) |
| InChIKey | FXZDYUOOPZXKRR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|