C11H16O2S2 — CID 82927723
4-(2-ethylbutylsulfanyl)thiophene-2-carboxylic acid (PubChem CID 82927723) has the molecular formula C11H16O2S2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-(2-ethylbutylsulfanyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(2-ethylbutylsulfanyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 82927723 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(2-ethylbutylsulfanyl)thiophene-2-carboxylic acid |
| SMILES | CCC(CC)CSc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C11H16O2S2/c1-3-8(4-2)6-14-9-5-10(11(12)13)15-7-9/h5,7-8H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | BATZRUCTDQBABC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |