C10H10N2O2S2 — CID 79140528
4-(2-pyrazol-1-ylethylsulfanyl)thiophene-2-carboxylic acid (PubChem CID 79140528) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-(2-pyrazol-1-ylethylsulfanyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(2-pyrazol-1-ylethylsulfanyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79140528 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-(2-pyrazol-1-ylethylsulfanyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SCCn2cccn2)cs1 |
| InChI | InChI=1S/C10H10N2O2S2/c13-10(14)9-6-8(7-16-9)15-5-4-12-3-1-2-11-12/h1-3,6-7H,4-5H2,(H,13,14) |
| InChIKey | DFPMTEIZGPIPEN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |